Compound Q&A

How is Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) typically synthesized?

Answer

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate
Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is typically synthesized via a multi-step process involving the condensation of 5-bromomethylpyrimidine and 3-hydroxybutanoic acid methyl ester. The reaction is catalyzed by a strong base like sodium hydride, and the product is isolated by recrystallization. The yield is moderate, around 60-70%, and the reaction is selective, giving a high yield of the desired product.

About

English Name Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate
Molecular Formula C9H12N2O4
Molecular Weight 212.2 g/mol
SMILES CC(CC(=O)OC)C1=C(N=CNC1=O)O
InChIKey XLADYKVTZFVWDT-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is a crystalline compound with a...

Compound Q&A

What industries use Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

When handling Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...