Compound Q&A

What industries use Voriconazole camphor sulfonate (CAS: 137234-71-0)?

Answer

Voriconazole camphor sulfonate
Voriconazole camphor sulfonate is primarily used in the pharmaceutical industry for the treatment of fungal infections. It is also utilized in some polymer-based applications for its antifungal properties.

About

English Name Voriconazole camphor sulfonate
Molecular Formula C26H30F3N5O5S
Molecular Weight 581.6 g/mol
SMILES CC(C1=NC=NC=C1F)C(CN2C=NC=N2)(C3=C(C=C(C=C3)F)F)O.CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C
InChIKey AMYMCJHOGKVJHB-CRFUWKMFSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Voriconazole camphor sulfonate (CAS: 137234-71-0)?

Voriconazole camphor sulfonate is crystalline in form with a molecular weight of approximately 804.8...

Compound Q&A

How is Voriconazole camphor sulfonate (CAS: 137234-71-0) typically synthesized?

Voriconazole camphor sulfonate is synthesized by reacting voriconazole with camphor sulfonic acid. T...

Compound Q&A

What precautions should be taken when handling Voriconazole camphor sulfonate (CAS: 137234-71-0)?

When handling Voriconazole camphor sulfonate, appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...