Compound Q&A

How is Voriconazole camphor sulfonate (CAS: 137234-71-0) typically synthesized?

Answer

Voriconazole camphor sulfonate
Voriconazole camphor sulfonate is synthesized by reacting voriconazole with camphor sulfonic acid. The process involves careful control of pH and temperature to achieve high selectivity and yield. Catalysts such as imidazole or triethylamine are used to enhance the reaction efficiency.

About

English Name Voriconazole camphor sulfonate
Molecular Formula C26H30F3N5O5S
Molecular Weight 581.6 g/mol
SMILES CC(C1=NC=NC=C1F)C(CN2C=NC=N2)(C3=C(C=C(C=C3)F)F)O.CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C
InChIKey AMYMCJHOGKVJHB-CRFUWKMFSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Voriconazole camphor sulfonate (CAS: 137234-71-0)?

Voriconazole camphor sulfonate is crystalline in form with a molecular weight of approximately 804.8...

Compound Q&A

What industries use Voriconazole camphor sulfonate (CAS: 137234-71-0)?

Voriconazole camphor sulfonate is primarily used in the pharmaceutical industry for the treatment of...

Compound Q&A

What precautions should be taken when handling Voriconazole camphor sulfonate (CAS: 137234-71-0)?

When handling Voriconazole camphor sulfonate, appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...