Compound Q&A

What precautions should be taken when handling (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

Answer

(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one
When handling (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated environment, preferably in a fume hood, to minimize inhalation risks. Spills should be cleaned up with care, and the material safety data sheet (MSDS) or SDS should be consulted for specific safety information and emergency response procedures.

About

English Name (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one
Molecular Formula C13H18N2O
Molecular Weight 218.2948 g/mol
SMILES C[C@@H]1N[C@@H](C)C(=O)N(C1)Cc1ccccc1
InChIKey GYDZGFZXQCOKRU-QWRGUYRKSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

The compound (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is a white crystalline ...

Compound Q&A

How is (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) typically synthesized?

(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is typically synthesized via a multi...

Compound Q&A

What industries use (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is primarily used in the pharmaceuti...

Compound Q&A

Is 4-Anilino-1H-1,2,3-triazole-5-carboxylic acid (CAS: 72693-60-8) safe?

4-Anilino-1H-1,2,3-triazole-5-carboxylic acid is generally considered safe when ...

72693-60-84-Anilino-1H-1,2,3-t...
Compound Q&A

How should waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) be handled?

Waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) should...

933697-27-92-(2-Aminoethyl)-1H-...
Compound Q&A

How is 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride (CAS: 38059-78-8) typically synthesized?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride is t...

38059-78-84-Amino-5-chloro-N-[...
Compound Q&A

What are the main uses of 2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8)?

2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8) is primarily...

92152-60-82-(4-Bromophenyl)-1-...