Compound Q&A

What are the physical and chemical properties of (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

Answer

(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one
The compound (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is a white crystalline solid with a molecular weight of approximately 278.33 g/mol. It has poor water solubility but is soluble in organic solvents like methanol and ethanol. The compound is known for its mild reactivity, primarily undergoing substitution reactions. It shows moderate lipophilicity, which is beneficial for certain pharmaceutical applications.

About

English Name (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one
Molecular Formula C13H18N2O
Molecular Weight 218.2948 g/mol
SMILES C[C@@H]1N[C@@H](C)C(=O)N(C1)Cc1ccccc1
InChIKey GYDZGFZXQCOKRU-QWRGUYRKSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) typically synthesized?

(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is typically synthesized via a multi...

Compound Q&A

What industries use (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

When handling (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6), it is essential to us...

Compound Q&A

Is 4-Anilino-1H-1,2,3-triazole-5-carboxylic acid (CAS: 72693-60-8) safe?

4-Anilino-1H-1,2,3-triazole-5-carboxylic acid is generally considered safe when ...

72693-60-84-Anilino-1H-1,2,3-t...
Compound Q&A

How should waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) be handled?

Waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) should...

933697-27-92-(2-Aminoethyl)-1H-...
Compound Q&A

How is 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride (CAS: 38059-78-8) typically synthesized?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride is t...

38059-78-84-Amino-5-chloro-N-[...
Compound Q&A

What are the main uses of 2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8)?

2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8) is primarily...

92152-60-82-(4-Bromophenyl)-1-...