Compound Q&A

How is (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) typically synthesized?

Answer

(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one
(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is typically synthesized via a multi-step process involving the coupling of benzyl chloride with dimethylamine, followed by ring closure using an appropriate condensation reagent. This synthesis often uses a phase transfer catalyst to enhance yield and selectivity, with the final product purified by recrystallization or column chromatography.

About

English Name (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one
Molecular Formula C13H18N2O
Molecular Weight 218.2948 g/mol
SMILES C[C@@H]1N[C@@H](C)C(=O)N(C1)Cc1ccccc1
InChIKey GYDZGFZXQCOKRU-QWRGUYRKSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

The compound (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is a white crystalline ...

Compound Q&A

What industries use (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

(3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6)?

When handling (3S,5S)-1-benzyl-3,5-dimethylpiperazin-2-one (CAS: 170211-02-6), it is essential to us...

Compound Q&A

Is 4-Anilino-1H-1,2,3-triazole-5-carboxylic acid (CAS: 72693-60-8) safe?

4-Anilino-1H-1,2,3-triazole-5-carboxylic acid is generally considered safe when ...

72693-60-84-Anilino-1H-1,2,3-t...
Compound Q&A

How should waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) be handled?

Waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) should...

933697-27-92-(2-Aminoethyl)-1H-...
Compound Q&A

How is 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride (CAS: 38059-78-8) typically synthesized?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride is t...

38059-78-84-Amino-5-chloro-N-[...
Compound Q&A

What are the main uses of 2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8)?

2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8) is primarily...

92152-60-82-(4-Bromophenyl)-1-...