Compound Q&A

What precautions should be taken when handling 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

Answer

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile
When handling 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0), it is essential to take appropriate safety measures. Always wear personal protective equipment (PPE) such as gloves, safety goggles, and lab coat. Work in a fume hood to minimize exposure and inhalation. Store the compound in a well-ventilated and cool area, away from direct sunlight. In case of spill, handle it carefully and follow the safety data sheet (SDS) guidelines for disposal.

About

English Name 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile
Molecular Formula C28H18N2
Molecular Weight 382.46 g/mol
SMILES N#CC1C([H])=C([H])C(=C([H])C=1[H])C(C1C([H])=C([H])C([H])=C([H])C=1[H])=C(C1C([H])=C([H])C([H])=C([H])C=1[H])C1C([H])=C([H])C(C#N)=C([H])C=1[H]
InChIKey PXMVEKBIIOGHRB-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) is a solid compound with a high...

Compound Q&A

How is 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) typically synthesized?

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile is typically synthesized by a coupling reaction bet...

Compound Q&A

What industries use 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) is used in various industries, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...