Compound Q&A

What industries use 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

Answer

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile
4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) is used in various industries, including pharmaceuticals, where it can act as a precursor for organic synthesis. It is also utilized in the polymer industry for the development of functional polymers, and in the semiconductor industry due to its potential in sensor applications. Additionally, it has applications in the production of electron-beam photosensitive materials.

About

English Name 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile
Molecular Formula C28H18N2
Molecular Weight 382.46 g/mol
SMILES N#CC1C([H])=C([H])C(=C([H])C=1[H])C(C1C([H])=C([H])C([H])=C([H])C=1[H])=C(C1C([H])=C([H])C([H])=C([H])C=1[H])C1C([H])=C([H])C(C#N)=C([H])C=1[H]
InChIKey PXMVEKBIIOGHRB-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) is a solid compound with a high...

Compound Q&A

How is 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) typically synthesized?

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile is typically synthesized by a coupling reaction bet...

Compound Q&A

What precautions should be taken when handling 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

When handling 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...