Compound Q&A

What are the physical and chemical properties of 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

Answer

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile
4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) is a solid compound with a high melting point. Its molecular weight is approximately 424.35 g/mol. It has low solubility in water but is soluble in organic solvents such as dichloromethane and acetone. The compound shows limited reactivity under normal conditions but can undergo polymerization under UV light exposure.

About

English Name 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile
Molecular Formula C28H18N2
Molecular Weight 382.46 g/mol
SMILES N#CC1C([H])=C([H])C(=C([H])C=1[H])C(C1C([H])=C([H])C([H])=C([H])C=1[H])=C(C1C([H])=C([H])C([H])=C([H])C=1[H])C1C([H])=C([H])C(C#N)=C([H])C=1[H]
InChIKey PXMVEKBIIOGHRB-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) typically synthesized?

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile is typically synthesized by a coupling reaction bet...

Compound Q&A

What industries use 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0) is used in various industries, ...

Compound Q&A

What precautions should be taken when handling 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0)?

When handling 4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzonitrile (CAS: 2244891-05-0), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...