Compound Q&A

What industries use 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5)?

Answer

3-(2-Oxopropyl)benzoic acid
3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5) is primarily used in the pharmaceutical industry for the synthesis of certain drugs, as well as in the polymer industry for the development of functional polymers. It also finds applications in sensors and semiconductors due to its chemical reactivity and functional groups.

About

English Name 3-(2-Oxopropyl)benzoic acid
Molecular Formula C10H10O3
Molecular Weight 178.18699999999998 g/mol
SMILES O=C(O)C1=CC=CC(CC(C)=O)=C1
InChIKey PUKRMMAKVJOWIF-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5)?

3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5) is a white crystalline solid with a molecular weight ...

Compound Q&A

How is 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5) typically synthesized?

3-(2-Oxopropyl)benzoic acid can be synthesized through the reaction of benzoic acid with acrylonitri...

Compound Q&A

What precautions should be taken when handling 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5)?

When handling 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5), it is important to use appropriate per...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...