Compound Q&A

What are the physical and chemical properties of 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5)?

Answer

3-(2-Oxopropyl)benzoic acid
3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5) is a white crystalline solid with a molecular weight of approximately 196.23 g/mol. It is slightly soluble in water and has a pKa of about 3.5. This compound is moderately reactive, especially in acidic conditions, and is used in various chemical reactions due to its carboxylic acid functionality.

About

English Name 3-(2-Oxopropyl)benzoic acid
Molecular Formula C10H10O3
Molecular Weight 178.18699999999998 g/mol
SMILES O=C(O)C1=CC=CC(CC(C)=O)=C1
InChIKey PUKRMMAKVJOWIF-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5) typically synthesized?

3-(2-Oxopropyl)benzoic acid can be synthesized through the reaction of benzoic acid with acrylonitri...

Compound Q&A

What industries use 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5)?

3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5) is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5)?

When handling 3-(2-Oxopropyl)benzoic acid (CAS: 205927-63-5), it is important to use appropriate per...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...