Compound Q&A

What precautions should be taken when handling 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

Answer

3-(Pyrazin-2-yl)benzoic acid
When handling 3-(Pyrazin-2-yl)benzoic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves and eye protection. Work should be conducted in a well-ventilated area or a fume hood to avoid inhalation of dust or vapors. Spills should be cleaned up carefully, and the material safety data sheet (MSDS) should be consulted for specific guidance on disposal and cleanup procedures.

About

English Name 3-(Pyrazin-2-yl)benzoic acid
Molecular Formula C11H8N2O2
Molecular Weight 200.2 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=NC=CN=C2
InChIKey FQEYELBTYMODMC-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

3-(Pyrazin-2-yl)benzoic acid has a crystalline form at room temperature. Its molecular weight is app...

Compound Q&A

How is 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0) typically synthesized?

3-(Pyrazin-2-yl)benzoic acid is usually synthesized by the condensation of 2-pyrazinecarboxylic acid...

Compound Q&A

What industries use 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

3-(Pyrazin-2-yl)benzoic acid is used in the pharmaceutical industry for the synthesis of certain dru...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...