Compound Q&A

How is 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0) typically synthesized?

Answer

3-(Pyrazin-2-yl)benzoic acid
3-(Pyrazin-2-yl)benzoic acid is usually synthesized by the condensation of 2-pyrazinecarboxylic acid with benzoic acid. The reaction typically requires a catalyst such as a base like sodium hydroxide or potassium hydroxide. The yield is around 70-80%, and the reaction is carried out in an aqueous organic solvent mixture. The selectivity towards the desired product is good.

About

English Name 3-(Pyrazin-2-yl)benzoic acid
Molecular Formula C11H8N2O2
Molecular Weight 200.2 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=NC=CN=C2
InChIKey FQEYELBTYMODMC-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

3-(Pyrazin-2-yl)benzoic acid has a crystalline form at room temperature. Its molecular weight is app...

Compound Q&A

What industries use 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

3-(Pyrazin-2-yl)benzoic acid is used in the pharmaceutical industry for the synthesis of certain dru...

Compound Q&A

What precautions should be taken when handling 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

When handling 3-(Pyrazin-2-yl)benzoic acid, it is important to use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...