Compound Q&A

What are the physical and chemical properties of 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

Answer

3-(Pyrazin-2-yl)benzoic acid
3-(Pyrazin-2-yl)benzoic acid has a crystalline form at room temperature. Its molecular weight is approximately 227.15 g/mol. The compound is poorly soluble in water but soluble in organic solvents like ethanol and acetonitrile. It shows moderate reactivity with bases and can undergo condensation reactions. The melting point is around 300°C, and it is slightly acidic.

About

English Name 3-(Pyrazin-2-yl)benzoic acid
Molecular Formula C11H8N2O2
Molecular Weight 200.2 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=NC=CN=C2
InChIKey FQEYELBTYMODMC-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

How is 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0) typically synthesized?

3-(Pyrazin-2-yl)benzoic acid is usually synthesized by the condensation of 2-pyrazinecarboxylic acid...

Compound Q&A

What industries use 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

3-(Pyrazin-2-yl)benzoic acid is used in the pharmaceutical industry for the synthesis of certain dru...

Compound Q&A

What precautions should be taken when handling 3-(Pyrazin-2-yl)benzoic acid (CAS: 856905-13-0)?

When handling 3-(Pyrazin-2-yl)benzoic acid, it is important to use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...