Compound Q&A

What industries use (E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate (CAS: 18474-55-0)?

Answer

(E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate
(E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate is used in the pharmaceutical industry for the synthesis of certain anti-inflammatory and antiparasitic drugs. It is also explored in polymer production for its potential as a stabilizer. Additionally, it may be used in the development of sensors and as a reagent in analytical chemistry.

About

CAS No 18474-55-0
English Name (E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate
Molecular Formula C11H13BrN2O2
Molecular Weight 285.14 g/mol
SMILES CCOC(=O)C(=NNC1=CC=CC=C1Br)C
InChIKey ABWATJIINFXJFJ-JYRVWZFOSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate (CAS: 18474-55-0)?

(E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate is a crystalline solid with a molecular weight of...

Compound Q&A

How is (E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate (CAS: 18474-55-0) typically synthesized?

(E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate is synthesized via a hydrazination reaction of et...

Compound Q&A

What precautions should be taken when handling (E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate (CAS: 18474-55-0)?

When handling (E)-Ethyl 2-(2-(2-bromophenyl)hydrazono)propanoate, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...