Compound Q&A

How should 4'-Deoxy Vincristine (CAS: 68135-16-0) be stored?

Answer

4'-Deoxy Vincristine
4'-Deoxy Vincristine (CAS: 68135-16-0) should be stored at a temperature between 2°C and 8°C (36°F to 46°F) to maintain its stability. It should be protected from light and stored in a tightly sealed container to prevent degradation. Avoid exposure to heat and moisture.

About

CAS No 68135-16-0
English Name 4'-Deoxy Vincristine
Molecular Formula C46H56N4O9
Molecular Weight 809 g/mol
SMILES CCC1CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC
InChIKey KLFUUCHXSFIPMH-VSBPWMKXSA-N
Last Updated: 2026-03-16 08:50

Related Q&A

Compound Q&A

What is 4'-Deoxy Vincristine (CAS: 68135-16-0)?

4'-Deoxy Vincristine, also known as 4'-Deoxyvincristine, is an anticancer drug derived from the plan...

Compound Q&A

What are the main uses of 4'-Deoxy Vincristine (CAS: 68135-16-0)?

4'-Deoxy Vincristine (CAS: 68135-16-0) is primarily used in the treatment of various cancers, includ...

Compound Q&A

Is 4'-Deoxy Vincristine (CAS: 68135-16-0) safe?

4'-Deoxy Vincristine (CAS: 68135-16-0) is generally considered safe when used under medical supervis...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...