Compound Q&A

Is 4'-Deoxy Vincristine (CAS: 68135-16-0) safe?

Answer

4'-Deoxy Vincristine
4'-Deoxy Vincristine (CAS: 68135-16-0) is generally considered safe when used under medical supervision. However, it can cause side effects such as peripheral neuropathy, bone marrow suppression, and gastrointestinal issues. Proper handling and administration by healthcare professionals are essential to minimize risks.

About

CAS No 68135-16-0
English Name 4'-Deoxy Vincristine
Molecular Formula C46H56N4O9
Molecular Weight 809 g/mol
SMILES CCC1CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC
InChIKey KLFUUCHXSFIPMH-VSBPWMKXSA-N
Last Updated: 2026-03-16 08:50

Related Q&A

Compound Q&A

What is 4'-Deoxy Vincristine (CAS: 68135-16-0)?

4'-Deoxy Vincristine, also known as 4'-Deoxyvincristine, is an anticancer drug derived from the plan...

Compound Q&A

What are the main uses of 4'-Deoxy Vincristine (CAS: 68135-16-0)?

4'-Deoxy Vincristine (CAS: 68135-16-0) is primarily used in the treatment of various cancers, includ...

Compound Q&A

How should 4'-Deoxy Vincristine (CAS: 68135-16-0) be stored?

4'-Deoxy Vincristine (CAS: 68135-16-0) should be stored at a temperature between 2°C and 8°C (36°F t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...