Compound Q&A

How should 2-{4-[(R)-(4-Chlorophenyl)phenyl]amino}benzoic acid (CAS: 705289-61-8) be stored?

Answer

2-{4-[(R)-(4-Chlorophenyl)(phe
2-{4-[(R)-(4-Chlorophenyl)phenyl]amino}benzoic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and light exposure. Additionally, it is crucial to store it under lock and key to ensure it is inaccessible to unauthorized personnel.

About

English Name 2-{4-[(R)-(4-Chlorophenyl)(phe
Molecular Formula C19H23ClN2O
Molecular Weight 330.86 g/mol
SMILES c1ccc(cc1)[C@H](c2ccc(cc2)Cl)N3CCN(CC3)CCO
InChIKey ZJQSBXXYLQGZBR-LJQANCHMSA-N
Last Updated: 2026-03-16 04:59

Related Q&A

Compound Q&A

What is 2-{4-[(R)-(4-Chlorophenyl)phenyl]amino}benzoic acid (CAS: 705289-61-8)?

2-{4-[(R)-(4-Chlorophenyl)phenyl]amino}benzoic acid, also known as Cilengitide, is a small molecule ...

Compound Q&A

What are the main uses of 2-{4-[(R)-(4-Chlorophenyl)phenyl]amino}benzoic acid (CAS: 705289-61-8)?

2-{4-[(R)-(4-Chlorophenyl)phenyl]amino}benzoic acid is primarily used in pharmaceutical research for...

Compound Q&A

Is 2-{4-[(R)-(4-Chlorophenyl)phenyl]amino}benzoic acid (CAS: 705289-61-8) safe?

While 2-{4-[(R)-(4-Chlorophenyl)phenyl]amino}benzoic acid is considered safe under controlled labora...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...