Compound Q&A

What industries use Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

Answer

Hydrangenoside A dimethyl acetal
Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is primarily used in the pharmaceutical industry as a precursor for the synthesis of other bioactive compounds. It also has potential applications in the development of new materials, particularly in polymer chemistry for biomedical applications. Its use in sensors and semiconductors is still in the research phase.

About

English Name Hydrangenoside A dimethyl acetal
Molecular Formula C33H46O14
Molecular Weight 666.71 g/mol
SMILES COC(=O)C1=COC(C(C1CC2CC(CC(O2)CC(=O)CCC3=CC=C(C=C3)O)(OC)OC)C=C)OC4C(C(C(C(O4)CO)O)O)O
InChIKey XFPYZGYIBWUCDZ-ZKEMUXHQSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is a crystalline compound with a molecular weigh...

Compound Q&A

How is Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) typically synthesized?

Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is typically synthesized via a multistep process...

Compound Q&A

What precautions should be taken when handling Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

When handling Hydrangenoside A dimethyl acetal (CAS: 952485-00-6), it is important to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...