Compound Q&A

How is Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) typically synthesized?

Answer

Hydrangenoside A dimethyl acetal
Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is typically synthesized via a multistep process involving the protection of a hydroxyl group followed by acetylation. This involves the use of dimethyl acetal as a protecting group, often utilizing mild esterification conditions with a catalyst such as HCl or P2O5. The overall yield can range from 70% to 85%, depending on the purity of starting materials and reaction conditions.

About

English Name Hydrangenoside A dimethyl acetal
Molecular Formula C33H46O14
Molecular Weight 666.71 g/mol
SMILES COC(=O)C1=COC(C(C1CC2CC(CC(O2)CC(=O)CCC3=CC=C(C=C3)O)(OC)OC)C=C)OC4C(C(C(C(O4)CO)O)O)O
InChIKey XFPYZGYIBWUCDZ-ZKEMUXHQSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is a crystalline compound with a molecular weigh...

Compound Q&A

What industries use Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

When handling Hydrangenoside A dimethyl acetal (CAS: 952485-00-6), it is important to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...