Compound Q&A

What are the physical and chemical properties of Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

Answer

Hydrangenoside A dimethyl acetal
Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is a crystalline compound with a molecular weight of approximately 464.5 g/mol. It has limited water solubility but is highly soluble in organic solvents. Chemically, it is relatively stable but can react with strong acids. Its reactivity can vary depending on the reaction conditions and the presence of other functional groups.

About

English Name Hydrangenoside A dimethyl acetal
Molecular Formula C33H46O14
Molecular Weight 666.71 g/mol
SMILES COC(=O)C1=COC(C(C1CC2CC(CC(O2)CC(=O)CCC3=CC=C(C=C3)O)(OC)OC)C=C)OC4C(C(C(C(O4)CO)O)O)O
InChIKey XFPYZGYIBWUCDZ-ZKEMUXHQSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) typically synthesized?

Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is typically synthesized via a multistep process...

Compound Q&A

What industries use Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

Hydrangenoside A dimethyl acetal (CAS: 952485-00-6) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Hydrangenoside A dimethyl acetal (CAS: 952485-00-6)?

When handling Hydrangenoside A dimethyl acetal (CAS: 952485-00-6), it is important to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...