Compound Q&A

What are the physical and chemical properties of N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine (CAS: 78888-06-9)?

Answer

N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine
N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine is a white to off-white crystalline solid with a molecular weight of approximately 296.3 g/mol. It has a high melting point of around 155-157°C and is slightly soluble in common organic solvents like ethanol and acetone. This compound is known to be chemically stable but can react under certain conditions to form polymers. It is generally non-toxic but may cause skin irritation if handled without proper protective equipment.

About

CAS No 78888-06-9
English Name N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine
Molecular Formula C26H24N2
Molecular Weight 364.49 g/mol
SMILES CC1=CC(=CC=C1)NC2=CC=C(C=C2)C3=CC=C(C=C3)NC4=CC=CC(=C4)C
InChIKey ONKCIMOQGCARHN-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine (CAS: 78888-06-9) typically synthesized?

N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine is synthesized through the coupling of 4,4'-diaminobip...

Compound Q&A

What industries use N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine (CAS: 78888-06-9)?

N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine is primarily used in the pharmaceutical and polymer in...

Compound Q&A

What precautions should be taken when handling N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine (CAS: 78888-06-9)?

When handling N,N'-Bis(3-methylphenyl)-4,4'-biphenyldiamine, it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...