Compound Q&A

What industries use 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole (CAS: 919802-98-5)?

Answer

4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole
4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole finds applications in the pharmaceutical industry for its potential as an intermediate in drug synthesis. It is also used in the polymer industry for developing functional polymers and in sensor technology for its sensing capabilities. Additionally, it plays a role in semiconductor manufacturing due to its unique chemical properties.

About

English Name 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole
Molecular Formula C24H21BrN2
Molecular Weight 417.3500000000001 g/mol
SMILES CC1=C(C(=NN1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C)Br
InChIKey WQMFKJANHGULTK-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole (CAS: 919802-98-5)?

4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole (CAS: 919802-98-5) typically synthesized?

4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole is typically synthesized via a multistep process involving...

Compound Q&A

What precautions should be taken when handling 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole (CAS: 919802-98-5)?

When handling 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole, it is essential to use appropriate personal...

Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline soli...

69604-00-8Ethyl 5-nitro-1-benz...
2296719-34-9N-{3-[({2-[(4-Hydrox...
Compound Q&A

How should waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) be handled?

Waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) sho...

13933-31-8Tetraamminepalladium...
Compound Q&A

What are the main uses of 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

This compound is primarily used in organic synthesis, particularly for the prepa...

1270030-08-42-[7-(tert-Butyl)pyr...