Compound Q&A

What are the physical and chemical properties of 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole (CAS: 919802-98-5)?

Answer

4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole
4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole is a crystalline compound with a molecular weight of approximately 511.43 g/mol. It has a low water solubility and high solubility in organic solvents like dichloromethane and acetonitrile. Chemically, it is relatively stable but can undergo bromination reactions under appropriate conditions. The compound reacts readily with nucleophiles and can be used in various synthetic transformations.

About

English Name 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole
Molecular Formula C24H21BrN2
Molecular Weight 417.3500000000001 g/mol
SMILES CC1=C(C(=NN1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C)Br
InChIKey WQMFKJANHGULTK-UHFFFAOYSA-N
Last Updated: 2026-03-11 12:33

Related Q&A

Compound Q&A

How is 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole (CAS: 919802-98-5) typically synthesized?

4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole is typically synthesized via a multistep process involving...

Compound Q&A

What industries use 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole (CAS: 919802-98-5)?

4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole finds applications in the pharmaceutical industry for its ...

Compound Q&A

What precautions should be taken when handling 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole (CAS: 919802-98-5)?

When handling 4-Bromo-3,5-dimethyl-1-trityl-1H-pyrazole, it is essential to use appropriate personal...

Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline soli...

69604-00-8Ethyl 5-nitro-1-benz...
2296719-34-9N-{3-[({2-[(4-Hydrox...
Compound Q&A

How should waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) be handled?

Waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) sho...

13933-31-8Tetraamminepalladium...
Compound Q&A

What are the main uses of 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

This compound is primarily used in organic synthesis, particularly for the prepa...

1270030-08-42-[7-(tert-Butyl)pyr...