Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

Answer

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine
When handling 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine, ensure the use of appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work in a well-ventilated area or fume hood to minimize inhalation risks. Follow standard laboratory safety protocols, and keep the substance away from sources of heat and light. In the event of a spill, use appropriate containment and clean up materials, and consult the Safety Data Sheet (SDS) for specific instructions.

About

English Name 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine
Molecular Formula C13H7Cl2N3
Molecular Weight 276.13 g/mol
SMILES c1ccc2cc(ccc2c1)c3nc(nc(n3)Cl)Cl
InChIKey ZAARQOHTIYBPNJ-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine has a crystalline form with a molecular weight of approxi...

Compound Q&A

How is 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8) typically synthesized?

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine is synthesized by the nucleophilic substitution of 2-naph...

Compound Q&A

What industries use 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine is used in the pharmaceutical industry for its antifungal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...