Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

Answer

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine
2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine has a crystalline form with a molecular weight of approximately 316.07 g/mol. It has limited aqueous solubility and high solubility in organic solvents like ethanol and acetone. This compound is moderately reactive, particularly towards nucleophilic substitution reactions. It does not readily undergo hydrolysis or photolysis under normal conditions.

About

English Name 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine
Molecular Formula C13H7Cl2N3
Molecular Weight 276.13 g/mol
SMILES c1ccc2cc(ccc2c1)c3nc(nc(n3)Cl)Cl
InChIKey ZAARQOHTIYBPNJ-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

How is 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8) typically synthesized?

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine is synthesized by the nucleophilic substitution of 2-naph...

Compound Q&A

What industries use 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine is used in the pharmaceutical industry for its antifungal...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

When handling 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine, ensure the use of appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...