Compound Q&A

What industries use 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

Answer

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine
2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine is used in the pharmaceutical industry for its antifungal properties. It is also utilized in the synthesis of semiconductors and sensors due to its electronic properties. In the polymer industry, it serves as a stabilizer and flame retardant.

About

English Name 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine
Molecular Formula C13H7Cl2N3
Molecular Weight 276.13 g/mol
SMILES c1ccc2cc(ccc2c1)c3nc(nc(n3)Cl)Cl
InChIKey ZAARQOHTIYBPNJ-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine has a crystalline form with a molecular weight of approxi...

Compound Q&A

How is 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8) typically synthesized?

2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine is synthesized by the nucleophilic substitution of 2-naph...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine (CAS: 112719-97-8)?

When handling 2,4-Dichloro-6-(2-naphthyl)-1,3,5-triazine, ensure the use of appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...