Compound Q&A

What precautions should be taken when handling 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

Answer

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride
When handling 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride, it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure that the compound is handled in a well-ventilated area or fume hood. Spills should be immediately neutralized with a suitable acid-base neutralizer and cleaned up with absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride
Molecular Formula C10H9ClN2O2S
Molecular Weight 256.714 g/mol
SMILES CN1C(=CC=N1)C2=CC(=CC=C2)S(=O)(=O)Cl
InChIKey XVYMMAKBNVXHKR-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is a crystalline compound with a molecular weig...

Compound Q&A

How is 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4) typically synthesized?

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is typically synthesized via a two-step process...

Compound Q&A

What industries use 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is primarily used in the pharmaceutical industr...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...