Compound Q&A

What are the physical and chemical properties of 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

Answer

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride
3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is a crystalline compound with a molecular weight of approximately 300.32 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and dichloromethane. This compound is known for its high reactivity, particularly in nucleophilic substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place to prevent degradation.

About

English Name 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride
Molecular Formula C10H9ClN2O2S
Molecular Weight 256.714 g/mol
SMILES CN1C(=CC=N1)C2=CC(=CC=C2)S(=O)(=O)Cl
InChIKey XVYMMAKBNVXHKR-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

How is 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4) typically synthesized?

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is typically synthesized via a two-step process...

Compound Q&A

What industries use 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

When handling 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride, it is crucial to use appropriate...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...