Compound Q&A

What industries use 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

Answer

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride
3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is primarily used in the pharmaceutical industry for the synthesis of various drug intermediates. It is also utilized in the polymer industry for the modification of polymers and in the electronics industry for semiconductor applications. Additionally, it finds use in the development of sensors due to its unique chemical properties.

About

English Name 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride
Molecular Formula C10H9ClN2O2S
Molecular Weight 256.714 g/mol
SMILES CN1C(=CC=N1)C2=CC(=CC=C2)S(=O)(=O)Cl
InChIKey XVYMMAKBNVXHKR-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is a crystalline compound with a molecular weig...

Compound Q&A

How is 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4) typically synthesized?

3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride is typically synthesized via a two-step process...

Compound Q&A

What precautions should be taken when handling 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride (CAS: 941716-85-4)?

When handling 3-(1-Methyl-1H-pyrazol-5-yl)benzenesulfonyl chloride, it is crucial to use appropriate...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...