Compound Q&A

What precautions should be taken when handling 2-(3,5-Difluorophenyl)pyrrolidine (CAS: 886503-11-3)?

Answer

2-(3,5-Difluorophenyl)pyrrolidine
When handling 2-(3,5-Difluorophenyl)pyrrolidine, it is essential to wear appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area, preferably a fume hood, to avoid inhalation or skin contact. In case of spill, immediately clean up with appropriate absorbent material and follow proper disposal procedures. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency instructions.

About

English Name 2-(3,5-Difluorophenyl)pyrrolidine
Molecular Formula C10H11F2N
Molecular Weight 183.2 g/mol
SMILES C1CC(NC1)C2=CC(=CC(=C2)F)F
InChIKey INAOTHVFVJELEL-UHFFFAOYSA-N
Last Updated: 2026-03-11 07:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3,5-Difluorophenyl)pyrrolidine (CAS: 886503-11-3)?

2-(3,5-Difluorophenyl)pyrrolidine is a colorless liquid at room temperature. Its molecular weight is...

Compound Q&A

How is 2-(3,5-Difluorophenyl)pyrrolidine (CAS: 886503-11-3) typically synthesized?

2-(3,5-Difluorophenyl)pyrrolidine is typically synthesized through a multistep process involving the...

Compound Q&A

What industries use 2-(3,5-Difluorophenyl)pyrrolidine (CAS: 886503-11-3)?

2-(3,5-Difluorophenyl)pyrrolidine is used in the pharmaceutical industry for the synthesis of certai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...