Compound Q&A

What industries use 2-Methyl-7-nitro-2H-indazole (CAS: 13436-58-3)?

Answer

2-Methyl-7-nitro-2H-indazole
2-Methyl-7-nitro-2H-indazole is used in the pharmaceutical industry for the synthesis of drug intermediates due to its reactivity and stability. It also finds applications in the sensor industry, particularly in the development of gas sensors, and in the semiconductor industry as a precursor for functional materials. Additionally, it is utilized in polymer synthesis for the development of advanced materials.

About

CAS No 13436-58-3
English Name 2-Methyl-7-nitro-2H-indazole
Molecular Formula C8H7N3O2
Molecular Weight 177.16 g/mol
SMILES CN1C=C2C=CC=C(C2=N1)[N+](=O)[O-]
InChIKey IFVSROJIKNMTNX-UHFFFAOYSA-N
Last Updated: 2026-03-11 04:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-7-nitro-2H-indazole (CAS: 13436-58-3)?

2-Methyl-7-nitro-2H-indazole is a crystalline solid with a molecular weight of approximately 213.09 ...

Compound Q&A

How is 2-Methyl-7-nitro-2H-indazole (CAS: 13436-58-3) typically synthesized?

2-Methyl-7-nitro-2H-indazole is typically synthesized via a nitration process of 2-methyl-2H-indazol...

Compound Q&A

What precautions should be taken when handling 2-Methyl-7-nitro-2H-indazole (CAS: 13436-58-3)?

Proper handling of 2-Methyl-7-nitro-2H-indazole requires the use of personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...