Compound Q&A

What industries use Ganoderic acid C2 (CAS: 98296-48-1)?

Answer

Ganoderic acid C2
Ganoderic acid C2 (CAS: 98296-48-1) is primarily used in the pharmaceutical and health supplement industries due to its potential health benefits. It is also explored for its applications in the food industry as a functional ingredient and in research for its potential in materials science and sensor technology.

About

CAS No 98296-48-1
English Name Ganoderic acid C2
Molecular Formula C30H46O7
Molecular Weight 518.68 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)O
InChIKey RERVSJVGWKIGTJ-VHYQLHQASA-N
Last Updated: 2026-03-11 04:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganoderic acid C2 (CAS: 98296-48-1)?

Ganoderic acid C2 (CAS: 98296-48-1) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is Ganoderic acid C2 (CAS: 98296-48-1) typically synthesized?

Ganoderic acid C2 (CAS: 98296-48-1) is typically synthesized through a multi-step process involving ...

Compound Q&A

What precautions should be taken when handling Ganoderic acid C2 (CAS: 98296-48-1)?

When handling Ganoderic acid C2 (CAS: 98296-48-1), it is important to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...