Compound Q&A

How is Ganoderic acid C2 (CAS: 98296-48-1) typically synthesized?

Answer

Ganoderic acid C2
Ganoderic acid C2 (CAS: 98296-48-1) is typically synthesized through a multi-step process involving the extraction from Ganoderma lucidum followed by chemical manipulation. Common synthetic routes include derivatization of ganoderol derivatives using catalytic hydrogenation and acetylation. The yield is generally around 50-70%, and the process involves the use of various catalysts to achieve high selectivity.

About

CAS No 98296-48-1
English Name Ganoderic acid C2
Molecular Formula C30H46O7
Molecular Weight 518.68 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)O
InChIKey RERVSJVGWKIGTJ-VHYQLHQASA-N
Last Updated: 2026-03-11 04:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganoderic acid C2 (CAS: 98296-48-1)?

Ganoderic acid C2 (CAS: 98296-48-1) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use Ganoderic acid C2 (CAS: 98296-48-1)?

Ganoderic acid C2 (CAS: 98296-48-1) is primarily used in the pharmaceutical and health supplement in...

Compound Q&A

What precautions should be taken when handling Ganoderic acid C2 (CAS: 98296-48-1)?

When handling Ganoderic acid C2 (CAS: 98296-48-1), it is important to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...