Compound Q&A

What are the physical and chemical properties of Ganoderic acid C2 (CAS: 98296-48-1)?

Answer

Ganoderic acid C2
Ganoderic acid C2 (CAS: 98296-48-1) is a crystalline compound with a molecular weight of approximately 728.65 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and methanol. Chemically, it is relatively stable under normal conditions but can react with strong acids or bases. It is commonly used in the pharmaceutical industry due to its bioactive properties.

About

CAS No 98296-48-1
English Name Ganoderic acid C2
Molecular Formula C30H46O7
Molecular Weight 518.68 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)O
InChIKey RERVSJVGWKIGTJ-VHYQLHQASA-N
Last Updated: 2026-03-11 04:00

Related Q&A

Compound Q&A

How is Ganoderic acid C2 (CAS: 98296-48-1) typically synthesized?

Ganoderic acid C2 (CAS: 98296-48-1) is typically synthesized through a multi-step process involving ...

Compound Q&A

What industries use Ganoderic acid C2 (CAS: 98296-48-1)?

Ganoderic acid C2 (CAS: 98296-48-1) is primarily used in the pharmaceutical and health supplement in...

Compound Q&A

What precautions should be taken when handling Ganoderic acid C2 (CAS: 98296-48-1)?

When handling Ganoderic acid C2 (CAS: 98296-48-1), it is important to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...