Compound Q&A

What industries use 2-Bromo-5-nitrobenzene-1-sulfonyl chloride (CAS: 98130-55-3)?

Answer

2-Bromo-5-nitrobenzene-1-sulfonyl chloride
2-Bromo-5-nitrobenzene-1-sulfonyl chloride finds application in pharmaceuticals, particularly in the synthesis of medicinal compounds. It is also used in the preparation of organic dyes and in polymer chemistry for developing functional materials. Additionally, it is utilized in the development of sensors and semiconductors.

About

CAS No 98130-55-3
English Name 2-Bromo-5-nitrobenzene-1-sulfonyl chloride
Molecular Formula C6H3BrClNO4S
Molecular Weight 300.51 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)Cl)Br
InChIKey OGKGGBNPVRGQQN-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitrobenzene-1-sulfonyl chloride (CAS: 98130-55-3)?

2-Bromo-5-nitrobenzene-1-sulfonyl chloride is a crystalline compound with a molecular weight of appr...

Compound Q&A

How is 2-Bromo-5-nitrobenzene-1-sulfonyl chloride (CAS: 98130-55-3) typically synthesized?

2-Bromo-5-nitrobenzene-1-sulfonyl chloride is synthesized via the reaction of 5-nitrobenzenesulfonic...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitrobenzene-1-sulfonyl chloride (CAS: 98130-55-3)?

When handling 2-Bromo-5-nitrobenzene-1-sulfonyl chloride, always wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...