Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitrobenzene-1-sulfonyl chloride (CAS: 98130-55-3)?

Answer

2-Bromo-5-nitrobenzene-1-sulfonyl chloride
2-Bromo-5-nitrobenzene-1-sulfonyl chloride is a crystalline compound with a molecular weight of approximately 293.04 g/mol. It has a high solubility in organic solvents like dichloromethane and acetone. Chemically, it is highly reactive, particularly with nucleophiles, and exhibits strong electrophilic aromatic substitution reactivity.

About

CAS No 98130-55-3
English Name 2-Bromo-5-nitrobenzene-1-sulfonyl chloride
Molecular Formula C6H3BrClNO4S
Molecular Weight 300.51 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)Cl)Br
InChIKey OGKGGBNPVRGQQN-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 2-Bromo-5-nitrobenzene-1-sulfonyl chloride (CAS: 98130-55-3) typically synthesized?

2-Bromo-5-nitrobenzene-1-sulfonyl chloride is synthesized via the reaction of 5-nitrobenzenesulfonic...

Compound Q&A

What industries use 2-Bromo-5-nitrobenzene-1-sulfonyl chloride (CAS: 98130-55-3)?

2-Bromo-5-nitrobenzene-1-sulfonyl chloride finds application in pharmaceuticals, particularly in the...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitrobenzene-1-sulfonyl chloride (CAS: 98130-55-3)?

When handling 2-Bromo-5-nitrobenzene-1-sulfonyl chloride, always wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...