Compound Q&A

What are the physical and chemical properties of Phenyl 4-amino-2-hydroxybenzoate (CAS: 133-11-9)?

Answer

Phenyl 4-amino-2-hydroxybenzoate
Phenyl 4-amino-2-hydroxybenzoate (CAS: 133-11-9) is a white to off-white crystalline solid with a molecular weight of approximately 252.25 g/mol. It has a solubility of 1.5 g/L in water at 20°C. Chemically, it is slightly basic and exhibits weak reactivity in acidic conditions. It is soluble in common organic solvents like ethanol and acetone.

About

CAS No 133-11-9
English Name Phenyl 4-amino-2-hydroxybenzoate
Molecular Formula C13H11NO3
Molecular Weight 229.24 g/mol
SMILES C1=CC=C(C=C1)OC(=O)C2=C(C=C(C=C2)N)O
InChIKey DNVVZWSVACQWJE-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is Phenyl 4-amino-2-hydroxybenzoate (CAS: 133-11-9) typically synthesized?

Phenyl 4-amino-2-hydroxybenzoate (CAS: 133-11-9) is typically synthesized via a condensation reactio...

Compound Q&A

What industries use Phenyl 4-amino-2-hydroxybenzoate (CAS: 133-11-9)?

Phenyl 4-amino-2-hydroxybenzoate (CAS: 133-11-9) is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling Phenyl 4-amino-2-hydroxybenzoate (CAS: 133-11-9)?

When handling Phenyl 4-amino-2-hydroxybenzoate (CAS: 133-11-9), appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...