Compound Q&A

What are the physical and chemical properties of Acetildenafil-d8 (CAS: 1189944-10-2)?

Answer

Acetildenafil-d8
Acetildenafil-d8 is a crystalline compound with a molecular weight of approximately 470.45 g/mol. It is slightly soluble in water and highly soluble in organic solvents like DMSO. It has a stable structure under normal laboratory conditions but reacts with strong bases. Its stable crystalline form allows it to be stored at room temperature away from moisture and heat.

About

English Name Acetildenafil-d8
Molecular Formula C25H26D8N6O3
Molecular Weight 474.63 g/mol
SMILES CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)C(=O)CN4CCN(CC4)CC)OCC)C
InChIKey RRBRQNALHKQCAI-FUEQIQQISA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is Acetildenafil-d8 (CAS: 1189944-10-2) typically synthesized?

Acetildenafil-d8 is synthesized via a multi-step process starting from sildenafil and acetate. The r...

Compound Q&A

What industries use Acetildenafil-d8 (CAS: 1189944-10-2)?

Acetildenafil-d8 is primarily used in the pharmaceutical industry for research and development purpo...

Compound Q&A

What precautions should be taken when handling Acetildenafil-d8 (CAS: 1189944-10-2)?

Proper personal protective equipment (PPE) should be worn, including gloves, goggles, and a lab coat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...