Compound Q&A

What industries use (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

Answer

(+/-)-N-3-Benzylnirvanol
The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is primarily used in the pharmaceutical industry as a chiral building block for the synthesis of drugs. It is also used in the polymer industry for creating advanced materials and in the sensor industry for developing highly sensitive detection devices. Its unique structure makes it valuable in semiconductor applications for its potential in electronic properties.

About

CAS No 93879-40-4
English Name (+/-)-N-3-Benzylnirvanol
Molecular Formula C18H18N2O2
Molecular Weight 294.35 g/mol
SMILES CCC1(C(=O)N(C(=O)N1)CC2=CC=CC=C2)C3=CC=CC=C3
InChIKey ZMZDHUHMXXALFX-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) typically synthesized?

The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is typically synthesized through a multistep process ...

Compound Q&A

What precautions should be taken when handling (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

When handling (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...