Compound Q&A

What are the physical and chemical properties of (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

Answer

(+/-)-N-3-Benzylnirvanol
The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is a crystalline solid with a molecular weight of approximately 246.26 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive towards bases and nucleophiles. It can be used as a chiral building block in organic synthesis due to its structural complexity and functional groups.

About

CAS No 93879-40-4
English Name (+/-)-N-3-Benzylnirvanol
Molecular Formula C18H18N2O2
Molecular Weight 294.35 g/mol
SMILES CCC1(C(=O)N(C(=O)N1)CC2=CC=CC=C2)C3=CC=CC=C3
InChIKey ZMZDHUHMXXALFX-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) typically synthesized?

The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is typically synthesized through a multistep process ...

Compound Q&A

What industries use (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is primarily used in the pharmaceutical industry as a...

Compound Q&A

What precautions should be taken when handling (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

When handling (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...