Compound Q&A

How is (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) typically synthesized?

Answer

(+/-)-N-3-Benzylnirvanol
The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is typically synthesized through a multistep process involving the protection of the hydroxyl group, subsequent benzyl substitution, and deprotection. Common catalysts such as palladium and ligands are used to enhance selectivity and yield. This process ensures the formation of the desired stereoisomer with high chemical purity.

About

CAS No 93879-40-4
English Name (+/-)-N-3-Benzylnirvanol
Molecular Formula C18H18N2O2
Molecular Weight 294.35 g/mol
SMILES CCC1(C(=O)N(C(=O)N1)CC2=CC=CC=C2)C3=CC=CC=C3
InChIKey ZMZDHUHMXXALFX-UHFFFAOYSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

The (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4) is primarily used in the pharmaceutical industry as a...

Compound Q&A

What precautions should be taken when handling (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4)?

When handling (+/-)-N-3-Benzylnirvanol (CAS: 93879-40-4), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...