Compound Q&A

What industries use 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

Answer

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid
8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is used in the pharmaceutical industry for its anti-inflammatory and analgesic effects. It also has applications in the polymer industry for improving adhesion and compatibility. Additionally, it is used in the production of sensors and semiconductors for its unique chemical properties.

About

CAS No 738-87-4
English Name 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid
Molecular Formula C19H34O2
Molecular Weight 294.48 g/mol
SMILES CCCCCCCCC1=C(C1)CCCCCCCC(=O)O
InChIKey PQRKPYLNZGDCFH-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is a solid with a crystalline form. It has a molecular w...

Compound Q&A

How is 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4) typically synthesized?

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is synthesized through a multistep process involving alk...

Compound Q&A

What precautions should be taken when handling 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

When handling 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid, wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...