Compound Q&A

How is 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4) typically synthesized?

Answer

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid
8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is synthesized through a multistep process involving alkylation and cyclization reactions. Commonly, a cyclic enol ester is formed and then converted into the final product. The reaction yields are typically around 70-80%, and the use of catalytic amounts of acid is required.

About

CAS No 738-87-4
English Name 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid
Molecular Formula C19H34O2
Molecular Weight 294.4789999999999 g/mol
SMILES CCCCCCCCC1=C(C1)CCCCCCCC(=O)O
InChIKey PQRKPYLNZGDCFH-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is a solid with a crystalline form. It has a molecular w...

Compound Q&A

What industries use 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is used in the pharmaceutical industry for its anti-infl...

Compound Q&A

What precautions should be taken when handling 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

When handling 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid, wear appropriate personal protective equi...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...