Compound Q&A

What are the physical and chemical properties of 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

Answer

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid
8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is a solid with a crystalline form. It has a molecular weight of 308.5 g/mol and a low solubility in water. This compound is moderately reactive, particularly towards nucleophiles. It is used in pharmaceutical and polymer applications.

About

CAS No 738-87-4
English Name 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid
Molecular Formula C19H34O2
Molecular Weight 294.48 g/mol
SMILES CCCCCCCCC1=C(C1)CCCCCCCC(=O)O
InChIKey PQRKPYLNZGDCFH-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

How is 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4) typically synthesized?

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is synthesized through a multistep process involving alk...

Compound Q&A

What industries use 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid is used in the pharmaceutical industry for its anti-infl...

Compound Q&A

What precautions should be taken when handling 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid (CAS: 738-87-4)?

When handling 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid, wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...