Compound Q&A

What precautions should be taken when handling 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7)?

Answer

2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid
When handling 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Store the compound in a cool, well-ventilated area away from heat sources. If a spill occurs, use appropriate spill cleanup procedures and consult the Safety Data Sheet (SDS) for detailed instructions. Always work in a fume hood to minimize exposure risks.

About

English Name 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid
Molecular Formula C10H18O3
Molecular Weight 186.25 g/mol
SMILES CC1(C)CC(CC(C)(C)O1)C(=O)O
InChIKey UOFVEPKQZXHQSB-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7)?

2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7) is a white crystalline ...

Compound Q&A

How is 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7) typically synthesized?

2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid can be synthesized through a multi-step pro...

Compound Q&A

What industries use 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7)?

2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7) is used in the pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...