Compound Q&A

What are the physical and chemical properties of 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7)?

Answer

2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid
2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7) is a white crystalline solid with a molecular weight of 224.23 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. This compound is moderately stable and exhibits good reactivity in esterification and amidation reactions.

About

English Name 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid
Molecular Formula C10H18O3
Molecular Weight 186.25 g/mol
SMILES CC1(C)CC(CC(C)(C)O1)C(=O)O
InChIKey UOFVEPKQZXHQSB-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

How is 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7) typically synthesized?

2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid can be synthesized through a multi-step pro...

Compound Q&A

What industries use 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7)?

2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7) is used in the pharmace...

Compound Q&A

What precautions should be taken when handling 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7)?

When handling 2,2,6,6-Tetramethyltetrahydro-2H-pyran-4-carboxylic acid (CAS: 1429421-99-7), it is es...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...