Compound Q&A

What industries use JHW 007 Hydrochloride (CAS: 202645-74-7)?

Answer

JHW 007 Hydrochloride
JHW 007 Hydrochloride is primarily used in the pharmaceutical industry for research purposes. It has also shown potential in the development of novel drug candidates and as a tool compound in chemical biology. Additionally, it may have applications in the production of sensors and semiconductors, although its use in these areas is less common.

About

English Name JHW 007 Hydrochloride
Molecular Formula C24H30ClF2NO
Molecular Weight 421.96 g/mol
SMILES CCCCN1C2CCC1CC(C2)OC(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F.Cl
InChIKey RHYMGBAYGRUKNZ-QKYUOBHYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of JHW 007 Hydrochloride (CAS: 202645-74-7)?

JHW 007 Hydrochloride is a crystalline solid with a molecular weight of approximately 383.6 g/mol. I...

Compound Q&A

How is JHW 007 Hydrochloride (CAS: 202645-74-7) typically synthesized?

JHW 007 Hydrochloride is synthesized via a multi-step process involving the condensation of a substi...

Compound Q&A

What precautions should be taken when handling JHW 007 Hydrochloride (CAS: 202645-74-7)?

When handling JHW 007 Hydrochloride, it is essential to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...