Compound Q&A

How is JHW 007 Hydrochloride (CAS: 202645-74-7) typically synthesized?

Answer

JHW 007 Hydrochloride
JHW 007 Hydrochloride is synthesized via a multi-step process involving the condensation of a substituted phenol and a substituted amine, followed by hydrochloric acid treatment to generate the hydrochloride salt. The reaction typically involves a Lewis acid catalyst and requires controlled temperature and pressure conditions to achieve high selectivity and yield.

About

English Name JHW 007 Hydrochloride
Molecular Formula C24H30ClF2NO
Molecular Weight 421.96 g/mol
SMILES CCCCN1C2CCC1CC(C2)OC(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F.Cl
InChIKey RHYMGBAYGRUKNZ-QKYUOBHYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of JHW 007 Hydrochloride (CAS: 202645-74-7)?

JHW 007 Hydrochloride is a crystalline solid with a molecular weight of approximately 383.6 g/mol. I...

Compound Q&A

What industries use JHW 007 Hydrochloride (CAS: 202645-74-7)?

JHW 007 Hydrochloride is primarily used in the pharmaceutical industry for research purposes. It has...

Compound Q&A

What precautions should be taken when handling JHW 007 Hydrochloride (CAS: 202645-74-7)?

When handling JHW 007 Hydrochloride, it is essential to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...