Compound Q&A

What industries use 2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone (CAS: 2274-66-0)?

Answer

2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone
2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone (CAS: 2274-66-0) is primarily used in the pharmaceutical and polymer industries. It serves as a key intermediate in the synthesis of various pharmaceuticals and polymers with specific functional groups. Additionally, it can be used in the production of sensors and semiconductors due to its reactive functional groups.

About

CAS No 2274-66-0
English Name 2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone
Molecular Formula C8H4Cl4O
Molecular Weight 257.93 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(=O)C(Cl)Cl
InChIKey LRXWJPURTZCTEH-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone (CAS: 2274-66-0)?

2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone (CAS: 2274-66-0) is a white crystalline solid with a mol...

Compound Q&A

How is 2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone (CAS: 2274-66-0) typically synthesized?

2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone (CAS: 2274-66-0) is typically synthesized via a condensa...

Compound Q&A

What precautions should be taken when handling 2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone (CAS: 2274-66-0)?

When handling 2,2-Dichloro-1-(2,4-dichlorophenyl)ethanone (CAS: 2274-66-0), it is important to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...